C27H37FN4O3Si — CID 54404668
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)butyl]-2-methoxy-N-methyl-5-(2H-triazol-4-yl)benzamide (PubChem CID 54404668) has the molecular formula C27H37FN4O3Si and a molecular weight of 512.70 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)butyl]-2-methoxy-N-methyl-5-(2H-triazol-4-yl)benzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)butyl]-2-methoxy-N-methyl-5-(2H-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 54404668 |
| Molecular Formula | C27H37FN4O3Si |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)butyl]-2-methoxy-N-methyl-5-(2H-triazol-4-yl)benzamide |
| SMILES | COc1ccc(-c2cn[nH]n2)cc1C(=O)N(C)CC(CCO[Si](C)(C)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H37FN4O3Si/c1-27(2,3)36(6,7)35-15-14-21(19-8-11-22(28)12-9-19)18-32(4)26(33)23-16-20(10-13-25(23)34-5)24-17-29-31-30-24/h8-13,16-17,21H,14-15,18H2,1-7H3,(H,29,30,31) |
| InChIKey | VPVQWFOAMUSWLR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|