2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid

C6H9NO5 — CID 54412439

IUPAC2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid
SMILESCCC(C(=O)O)C(=O)C(=O)NO
InChIInChI=1S/C6H9NO5/c1-2-3(6(10)11)4(8)5(9)7-12/h3,12H,2H2,1H3,(H,7,9)(H,10,11)
InChIKeyVVBKMTCVYQIEFI-UHFFFAOYSA-N
MW175.14 g/mol
LogP-0.83
Rot. Bonds4

About 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid

2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid (PubChem CID 54412439) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid.

Molecular Properties

Compound Name2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid
PubChem CID54412439
Molecular FormulaC6H9NO5
Molecular Weight175.14 g/mol
Exact Mass175.05
IUPAC Name2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid
SMILESCCC(C(=O)O)C(=O)C(=O)NO
InChIInChI=1S/C6H9NO5/c1-2-3(6(10)11)4(8)5(9)7-12/h3,12H,2H2,1H3,(H,7,9)(H,10,11)
InChIKeyVVBKMTCVYQIEFI-UHFFFAOYSA-N
XLogP-0.83
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.14
LogP ≤ 5-0.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid?
The IUPAC name of 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid (CID 54412439) is 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid.
What is the SMILES notation for 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid?
The canonical SMILES for 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid is CCC(C(=O)O)C(=O)C(=O)NO.
What is the InChIKey of 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid?
The InChIKey is VVBKMTCVYQIEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO5/c1-2-3(6(10)11)4(8)5(9)7-12/h3,12H,2H2,1H3,(H,7,9)(H,10,11).
What are the key properties of 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid?
2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid has a molecular weight of 175.14 g/mol, XLogP of -0.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(hydroxyamino)-3,4-dioxobutanoic acid is sourced from PubChem (CID 54412439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).