C19H29NO5 — CID 54416416
7-[2-ethyl-5-hydroxy-4-(2-nitrosoethyl)phenoxy]-2,2-dimethylheptanoic acid (PubChem CID 54416416) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 7-[2-ethyl-5-hydroxy-4-(2-nitrosoethyl)phenoxy]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[2-ethyl-5-hydroxy-4-(2-nitrosoethyl)phenoxy]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 54416416 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 7-[2-ethyl-5-hydroxy-4-(2-nitrosoethyl)phenoxy]-2,2-dimethylheptanoic acid |
| SMILES | CCc1cc(CCN=O)c(O)cc1OCCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C19H29NO5/c1-4-14-12-15(8-10-20-24)16(21)13-17(14)25-11-7-5-6-9-19(2,3)18(22)23/h12-13,21H,4-11H2,1-3H3,(H,22,23) |
| InChIKey | VXTIKWSCYBUDSQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|