C24H28O2 — CID 54420564
2-[3-(2,3,4,5-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-yl)prop-1-enyl]benzoic acid (PubChem CID 54420564) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[3-(2,3,4,5-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2-[3-(2,3,4,5-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54420564 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[3-(2,3,4,5-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-yl)prop-1-enyl]benzoic acid |
| SMILES | Cc1cccc2c1C(C)C(C)C(C)C2CC=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C24H28O2/c1-15-9-7-14-22-20(17(3)16(2)18(4)23(15)22)13-8-11-19-10-5-6-12-21(19)24(25)26/h5-12,14,16-18,20H,13H2,1-4H3,(H,25,26) |
| InChIKey | WAMYHNNXDGVZDC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |