C14H11NO3S — CID 54460063
7-oxo-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid (PubChem CID 54460063) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 7-oxo-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid.
| Compound Name | 7-oxo-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 54460063 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 7-oxo-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid |
| SMILES | O=C1SNc2cc(C(=O)O)ccc2C2=C1C=CCC2 |
| InChI | InChI=1S/C14H11NO3S/c16-13(17)8-5-6-10-9-3-1-2-4-11(9)14(18)19-15-12(10)7-8/h2,4-7,15H,1,3H2,(H,16,17) |
| InChIKey | XAZOBNSLROVUDO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|