C14H11NO2S2 — CID 54102818
7-sulfanylidene-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid (PubChem CID 54102818) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 7-sulfanylidene-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid.
| Compound Name | 7-sulfanylidene-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 54102818 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 7-sulfanylidene-10,11-dihydro-5H-benzo[d][2,1]benzothiazepine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)NSC(=S)C1=C2CCC=C1 |
| InChI | InChI=1S/C14H11NO2S2/c16-13(17)8-5-6-10-9-3-1-2-4-11(9)14(18)19-15-12(10)7-8/h2,4-7,15H,1,3H2,(H,16,17) |
| InChIKey | NBRXPUQZRLUWHQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|