C28H18Cl5N3O3 — CID 54471267
2,4-dichloro-N-[4-[9-(2,2,2-trichloroacetyl)-6,11-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6-carbonyl]phenyl]benzamide (PubChem CID 54471267) has the molecular formula C28H18Cl5N3O3 and a molecular weight of 621.74 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[9-(2,2,2-trichloroacetyl)-6,11-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6-carbonyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[9-(2,2,2-trichloroacetyl)-6,11-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 54471267 |
| Molecular Formula | C28H18Cl5N3O3 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 618.98 |
| IUPAC Name | 2,4-dichloro-N-[4-[9-(2,2,2-trichloroacetyl)-6,11-dihydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6-carbonyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)C2Nc3ccccc3Cn3c(C(=O)C(Cl)(Cl)Cl)ccc32)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H18Cl5N3O3/c29-17-7-10-19(20(30)13-17)27(39)34-18-8-5-15(6-9-18)25(37)24-22-11-12-23(26(38)28(31,32)33)36(22)14-16-3-1-2-4-21(16)35-24/h1-13,24,35H,14H2,(H,34,39) |
| InChIKey | XINQQPXHMDCJQI-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|