C16H26O8 — CID 54512081
2-[3-(2,4,4-trimethylpentan-2-yloxycarbonyloxy)dioxetan-3-yl]oxyethyl prop-2-enoate (PubChem CID 54512081) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[3-(2,4,4-trimethylpentan-2-yloxycarbonyloxy)dioxetan-3-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[3-(2,4,4-trimethylpentan-2-yloxycarbonyloxy)dioxetan-3-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 54512081 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[3-(2,4,4-trimethylpentan-2-yloxycarbonyloxy)dioxetan-3-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC1(OC(=O)OC(C)(C)CC(C)(C)C)COO1 |
| InChI | InChI=1S/C16H26O8/c1-7-12(17)19-8-9-20-16(11-21-24-16)23-13(18)22-15(5,6)10-14(2,3)4/h7H,1,8-11H2,2-6H3 |
| InChIKey | YJVJLXNQVJJHEH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|