C21H24ClF3N5O3S+ — CID 54513109
[1-(3-chloro-4-pyridinyl)piperazin-1-ium-1-yl]-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 54513109) has the molecular formula C21H24ClF3N5O3S+ and a molecular weight of 518.97 g/mol. Its IUPAC name is [1-(3-chloro-4-pyridinyl)piperazin-1-ium-1-yl]-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | [1-(3-chloro-4-pyridinyl)piperazin-1-ium-1-yl]-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 54513109 |
| Molecular Formula | C21H24ClF3N5O3S+ |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | [1-(3-chloro-4-pyridinyl)piperazin-1-ium-1-yl]-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)[N+]1(c2ccncc2Cl)CCNCC1 |
| InChI | InChI=1S/C21H24ClF3N5O3S/c22-18-15-27-6-5-19(18)30(13-7-26-8-14-30)20(31)28-9-11-29(12-10-28)34(32,33)17-3-1-16(2-4-17)21(23,24)25/h1-6,15,26H,7-14H2/q+1 |
| InChIKey | LIHPHJSHPKOWRZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|