C14H15NO2 — CID 54515900
2-[2-(3-aminophenyl)ethyl]benzene-1,4-diol (PubChem CID 54515900) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)ethyl]benzene-1,4-diol.
| Compound Name | 2-[2-(3-aminophenyl)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 54515900 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-[2-(3-aminophenyl)ethyl]benzene-1,4-diol |
| SMILES | Nc1cccc(CCc2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C14H15NO2/c15-12-3-1-2-10(8-12)4-5-11-9-13(16)6-7-14(11)17/h1-3,6-9,16-17H,4-5,15H2 |
| InChIKey | YMJTVOGXEIIBPS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|