C18H16Cl3N3O2 — CID 54527720
2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide (PubChem CID 54527720) has the molecular formula C18H16Cl3N3O2 and a molecular weight of 412.70 g/mol. Its IUPAC name is 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 54527720 |
| Molecular Formula | C18H16Cl3N3O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide |
| SMILES | C=CCN(C)c1c(Cl)cc(NC(=O)NC(=O)c2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O2/c1-3-8-24(2)16-14(20)9-11(10-15(16)21)22-18(26)23-17(25)12-6-4-5-7-13(12)19/h3-7,9-10H,1,8H2,2H3,(H2,22,23,25,26) |
| InChIKey | YUGZYFIOEQKRAP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|