About 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide
2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide (PubChem CID 54527720) has the molecular formula C18H16Cl3N3O2
and a molecular weight of 412.70 g/mol. Its IUPAC name is 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide |
| PubChem CID | 54527720 |
| Molecular Formula | C18H16Cl3N3O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide |
| SMILES | C=CCN(C)c1c(Cl)cc(NC(=O)NC(=O)c2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O2/c1-3-8-24(2)16-14(20)9-11(10-15(16)21)22-18(26)23-17(25)12-6-4-5-7-13(12)19/h3-7,9-10H,1,8H2,2H3,(H2,22,23,25,26) |
| InChIKey | YUGZYFIOEQKRAP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide?
The IUPAC name of 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide (CID 54527720) is 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide.
What is the SMILES notation for 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide?
The canonical SMILES for 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide is C=CCN(C)c1c(Cl)cc(NC(=O)NC(=O)c2ccccc2Cl)cc1Cl.
What is the InChIKey of 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide?
The InChIKey is YUGZYFIOEQKRAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl3N3O2/c1-3-8-24(2)16-14(20)9-11(10-15(16)21)22-18(26)23-17(25)12-6-4-5-7-13(12)19/h3-7,9-10H,1,8H2,2H3,(H2,22,23,25,26).
What are the key properties of 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide?
2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide has a molecular weight of 412.70 g/mol, XLogP of 5.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[[3,5-dichloro-4-[methyl(prop-2-enyl)amino]phenyl]carbamoyl]benzamide is sourced from PubChem (CID 54527720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).