C12H14N2O3 — CID 545372
1-(2,1,3-benzoxadiazol-5-yloxy)-3,3-dimethylbutan-2-one (PubChem CID 545372) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-5-yloxy)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(2,1,3-benzoxadiazol-5-yloxy)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 545372 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-5-yloxy)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)COc1ccc2nonc2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-12(2,3)11(15)7-16-8-4-5-9-10(6-8)14-17-13-9/h4-6H,7H2,1-3H3 |
| InChIKey | VVDLTUZGBFOAKJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |