C27H38F17N2O4P — CID 54554615
4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)undecoxy-morpholin-4-ylphosphoryl]morpholine (PubChem CID 54554615) has the molecular formula C27H38F17N2O4P and a molecular weight of 808.55 g/mol. Its IUPAC name is 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)undecoxy-morpholin-4-ylphosphoryl]morpholine.
| Compound Name | 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)undecoxy-morpholin-4-ylphosphoryl]morpholine |
|---|---|
| PubChem CID | 54554615 |
| Molecular Formula | C27H38F17N2O4P |
| Molecular Weight | 808.55 g/mol |
| Exact Mass | 808.23 |
| IUPAC Name | 4-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)undecoxy-morpholin-4-ylphosphoryl]morpholine |
| SMILES | CCCCCCCCCC(COP(=O)(N1CCOCC1)N1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H38F17N2O4P/c1-2-3-4-5-6-7-8-9-19(18-50-51(47,45-10-14-48-15-11-45)46-12-16-49-17-13-46)20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44/h19H,2-18H2,1H3 |
| InChIKey | ZMHJPIWMOLKAHC-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.55 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|