C14H14N2O5 — CID 54567435
methyl 3-(6,8-dimethoxy-4-oxoquinazolin-3-yl)prop-2-enoate (PubChem CID 54567435) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 3-(6,8-dimethoxy-4-oxoquinazolin-3-yl)prop-2-enoate.
| Compound Name | methyl 3-(6,8-dimethoxy-4-oxoquinazolin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54567435 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | methyl 3-(6,8-dimethoxy-4-oxoquinazolin-3-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cn1cnc2c(OC)cc(OC)cc2c1=O |
| InChI | InChI=1S/C14H14N2O5/c1-19-9-6-10-13(11(7-9)20-2)15-8-16(14(10)18)5-4-12(17)21-3/h4-8H,1-3H3 |
| InChIKey | ZUVMMGOMQCSVMW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|