C36H52N2O8 — CID 54570510
2,2-bis[5,5-dimethyl-3-oxo-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexen-1-yl]hexanedioic acid (PubChem CID 54570510) has the molecular formula C36H52N2O8 and a molecular weight of 640.82 g/mol. Its IUPAC name is 2,2-bis[5,5-dimethyl-3-oxo-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexen-1-yl]hexanedioic acid.
| Compound Name | 2,2-bis[5,5-dimethyl-3-oxo-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexen-1-yl]hexanedioic acid |
|---|---|
| PubChem CID | 54570510 |
| Molecular Formula | C36H52N2O8 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | 2,2-bis[5,5-dimethyl-3-oxo-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexen-1-yl]hexanedioic acid |
| SMILES | C=CCON=C(CCC)C1=C(C(CCCC(=O)O)(C(=O)O)C2=C(C(CCC)=NOCC=C)C(=O)CC(C)(C)C2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C36H52N2O8/c1-9-14-26(37-45-18-11-3)31-24(20-34(5,6)22-28(31)39)36(33(43)44,17-13-16-30(41)42)25-21-35(7,8)23-29(40)32(25)27(15-10-2)38-46-19-12-4/h11-12H,3-4,9-10,13-23H2,1-2,5-8H3,(H,41,42)(H,43,44) |
| InChIKey | ZWXLKMSAQGEKIJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|