C24H26ClF3N4O3 — CID 5459753
methyl (2R,5R)-5-benzyl-5-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propylcarbamoyl]-2-methyl-2H-pyrrole-1-carboxylate (PubChem CID 5459753) has the molecular formula C24H26ClF3N4O3 and a molecular weight of 510.94 g/mol. Its IUPAC name is methyl (2R,5R)-5-benzyl-5-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propylcarbamoyl]-2-methyl-2H-pyrrole-1-carboxylate.
| Compound Name | methyl (2R,5R)-5-benzyl-5-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propylcarbamoyl]-2-methyl-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 5459753 |
| Molecular Formula | C24H26ClF3N4O3 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | methyl (2R,5R)-5-benzyl-5-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propylcarbamoyl]-2-methyl-2H-pyrrole-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C)C=C[C@]1(Cc1ccccc1)C(=O)NCCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C24H26ClF3N4O3/c1-16-9-10-23(32(16)22(34)35-2,14-17-7-4-3-5-8-17)21(33)30-12-6-11-29-20-19(25)13-18(15-31-20)24(26,27)28/h3-5,7-10,13,15-16H,6,11-12,14H2,1-2H3,(H,29,31)(H,30,33)/t16-,23+/m1/s1 |
| InChIKey | WPAUIKGBCFXUMT-MWTRTKDXSA-N |
| XLogP | 4.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|