C15H17N5O4S — CID 54604457
[(E)-[1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea (PubChem CID 54604457) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is [(E)-[1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 54604457 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [(E)-[1-[(4,5-dimethoxy-2-nitrophenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea |
| SMILES | COc1cc(Cn2cccc2/C=N/NC(N)=S)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H17N5O4S/c1-23-13-6-10(12(20(21)22)7-14(13)24-2)9-19-5-3-4-11(19)8-17-18-15(16)25/h3-8H,9H2,1-2H3,(H3,16,18,25)/b17-8+ |
| InChIKey | LFDQFTOTUOFISY-CAOOACKPSA-N |
| XLogP | 1.63 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|