C27H32N4O2 — CID 54665179
(3aS,4S,9bR)-8-(3-cyanophenyl)-N-cyclohexyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 54665179) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (3aS,4S,9bR)-8-(3-cyanophenyl)-N-cyclohexyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aS,4S,9bR)-8-(3-cyanophenyl)-N-cyclohexyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 54665179 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (3aS,4S,9bR)-8-(3-cyanophenyl)-N-cyclohexyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(-c3cccc(C#N)c3)cc2[C@H]2[C@H](CCN2C(=O)NC2CCCCC2)[C@H]1CO |
| InChI | InChI=1S/C27H32N4O2/c1-30-24-11-10-20(19-7-5-6-18(14-19)16-28)15-23(24)26-22(25(30)17-32)12-13-31(26)27(33)29-21-8-3-2-4-9-21/h5-7,10-11,14-15,21-22,25-26,32H,2-4,8-9,12-13,17H2,1H3,(H,29,33)/t22-,25-,26-/m1/s1 |
| InChIKey | DMOXRIFYDYXMLV-DNRSQYFGSA-N |
| XLogP | 4.44 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |