C26H30N4O2 — CID 54665798
(3aS,4R,9bR)-8-(4-cyanophenyl)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 54665798) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is (3aS,4R,9bR)-8-(4-cyanophenyl)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aS,4R,9bR)-8-(4-cyanophenyl)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 54665798 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3aS,4R,9bR)-8-(4-cyanophenyl)-N-cyclopentyl-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(-c3ccc(C#N)cc3)cc2[C@H]2[C@H](CCN2C(=O)NC2CCCC2)[C@@H]1CO |
| InChI | InChI=1S/C26H30N4O2/c1-29-23-11-10-19(18-8-6-17(15-27)7-9-18)14-22(23)25-21(24(29)16-31)12-13-30(25)26(32)28-20-4-2-3-5-20/h6-11,14,20-21,24-25,31H,2-5,12-13,16H2,1H3,(H,28,32)/t21-,24+,25-/m1/s1 |
| InChIKey | UUIHSLJAACWLQP-IEZKXTBUSA-N |
| XLogP | 4.05 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |