C26H29F2N3O2 — CID 134829798
(3aR,4S,9bS)-8-(cyclohexen-1-yl)-N-(2,5-difluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 134829798) has the molecular formula C26H29F2N3O2 and a molecular weight of 453.53 g/mol. Its IUPAC name is (3aR,4S,9bS)-8-(cyclohexen-1-yl)-N-(2,5-difluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aR,4S,9bS)-8-(cyclohexen-1-yl)-N-(2,5-difluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 134829798 |
| Molecular Formula | C26H29F2N3O2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (3aR,4S,9bS)-8-(cyclohexen-1-yl)-N-(2,5-difluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(C3=CCCCC3)cc2[C@@H]2[C@@H](CCN2C(=O)Nc2cc(F)ccc2F)[C@H]1CO |
| InChI | InChI=1S/C26H29F2N3O2/c1-30-23-10-7-17(16-5-3-2-4-6-16)13-20(23)25-19(24(30)15-32)11-12-31(25)26(33)29-22-14-18(27)8-9-21(22)28/h5,7-10,13-14,19,24-25,32H,2-4,6,11-12,15H2,1H3,(H,29,33)/t19-,24+,25-/m0/s1 |
| InChIKey | PCTMECUMRLYFMY-OWAUWMPXSA-N |
| XLogP | 5.33 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|