C28H31N3O4 — CID 54666099
(3aR,4S,9bS)-4-(hydroxymethyl)-N-(2-methoxyphenyl)-8-(3-methoxyphenyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 54666099) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(hydroxymethyl)-N-(2-methoxyphenyl)-8-(3-methoxyphenyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aR,4S,9bS)-4-(hydroxymethyl)-N-(2-methoxyphenyl)-8-(3-methoxyphenyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 54666099 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (3aR,4S,9bS)-4-(hydroxymethyl)-N-(2-methoxyphenyl)-8-(3-methoxyphenyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | COc1cccc(-c2ccc3c(c2)[C@@H]2[C@@H](CCN2C(=O)Nc2ccccc2OC)[C@@H](CO)N3C)c1 |
| InChI | InChI=1S/C28H31N3O4/c1-30-24-12-11-19(18-7-6-8-20(15-18)34-2)16-22(24)27-21(25(30)17-32)13-14-31(27)28(33)29-23-9-4-5-10-26(23)35-3/h4-12,15-16,21,25,27,32H,13-14,17H2,1-3H3,(H,29,33)/t21-,25+,27-/m0/s1 |
| InChIKey | RHBRXAKGQGFDTH-BBVXACFBSA-N |
| XLogP | 4.78 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |