C20H27NO5 — CID 54676308
tert-butyl 3-hydroxy-1-[(2R)-4-hydroxy-2-phenylmethoxybutyl]pyrrole-2-carboxylate (PubChem CID 54676308) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-1-[(2R)-4-hydroxy-2-phenylmethoxybutyl]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-1-[(2R)-4-hydroxy-2-phenylmethoxybutyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 54676308 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl 3-hydroxy-1-[(2R)-4-hydroxy-2-phenylmethoxybutyl]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(O)ccn1C[C@@H](CCO)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-20(2,3)26-19(24)18-17(23)9-11-21(18)13-16(10-12-22)25-14-15-7-5-4-6-8-15/h4-9,11,16,22-23H,10,12-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | BQQLXXFTQZYZCU-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |