C20H15NO3S — CID 54689835
4-hydroxy-3-(4-phenylmethoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 54689835) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-hydroxy-3-(4-phenylmethoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one.
| Compound Name | 4-hydroxy-3-(4-phenylmethoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 54689835 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-hydroxy-3-(4-phenylmethoxyphenyl)-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1cc(O)c2c(-c3ccc(OCc4ccccc4)cc3)csc2[nH]1 |
| InChI | InChI=1S/C20H15NO3S/c22-17-10-18(23)21-20-19(17)16(12-25-20)14-6-8-15(9-7-14)24-11-13-4-2-1-3-5-13/h1-10,12H,11H2,(H2,21,22,23) |
| InChIKey | ZFWUUKHOWIHUFJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |