C19H19F6NO4 — CID 54702686
ethyl (2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-hydroxy-5-oxo-2-propan-2-yl-2H-pyrrole-4-carboxylate (PubChem CID 54702686) has the molecular formula C19H19F6NO4 and a molecular weight of 439.35 g/mol. Its IUPAC name is ethyl (2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-hydroxy-5-oxo-2-propan-2-yl-2H-pyrrole-4-carboxylate.
| Compound Name | ethyl (2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-hydroxy-5-oxo-2-propan-2-yl-2H-pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 54702686 |
| Molecular Formula | C19H19F6NO4 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | ethyl (2S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-hydroxy-5-oxo-2-propan-2-yl-2H-pyrrole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@H](C(C)C)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C19H19F6NO4/c1-4-30-17(29)13-15(27)14(9(2)3)26(16(13)28)8-10-5-11(18(20,21)22)7-12(6-10)19(23,24)25/h5-7,9,14,27H,4,8H2,1-3H3/t14-/m0/s1 |
| InChIKey | IXAAFHNJJPRZRY-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|