C14H12NO6- — CID 54706473
2-carboxy-5-[1-[(3R,5S)-5-methyl-2,4-dioxooxolan-3-yl]ethenylamino]phenolate (PubChem CID 54706473) has the molecular formula C14H12NO6- and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-carboxy-5-[1-[(3R,5S)-5-methyl-2,4-dioxooxolan-3-yl]ethenylamino]phenolate.
| Compound Name | 2-carboxy-5-[1-[(3R,5S)-5-methyl-2,4-dioxooxolan-3-yl]ethenylamino]phenolate |
|---|---|
| PubChem CID | 54706473 |
| Molecular Formula | C14H12NO6- |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-carboxy-5-[1-[(3R,5S)-5-methyl-2,4-dioxooxolan-3-yl]ethenylamino]phenolate |
| SMILES | C=C(Nc1ccc(C(=O)O)c([O-])c1)[C@H]1C(=O)O[C@@H](C)C1=O |
| InChI | InChI=1S/C14H13NO6/c1-6(11-12(17)7(2)21-14(11)20)15-8-3-4-9(13(18)19)10(16)5-8/h3-5,7,11,15-16H,1H2,2H3,(H,18,19)/p-1/t7-,11+/m0/s1 |
| InChIKey | HUBRZFXDQPNYLG-WRWORJQWSA-M |
| XLogP | 0.51 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|