C13H12N2O7S2 — CID 54713732
(Z)-4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfonylamino]-3-hydroxy-4-oxobut-2-enoic acid (PubChem CID 54713732) has the molecular formula C13H12N2O7S2 and a molecular weight of 372.38 g/mol. Its IUPAC name is (Z)-4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfonylamino]-3-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfonylamino]-3-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54713732 |
| Molecular Formula | C13H12N2O7S2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (Z)-4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfonylamino]-3-hydroxy-4-oxobut-2-enoic acid |
| SMILES | CCOc1ccc2nc(S(=O)(=O)NC(=O)/C(O)=C/C(=O)O)sc2c1 |
| InChI | InChI=1S/C13H12N2O7S2/c1-2-22-7-3-4-8-10(5-7)23-13(14-8)24(20,21)15-12(19)9(16)6-11(17)18/h3-6,16H,2H2,1H3,(H,15,19)(H,17,18)/b9-6- |
| InChIKey | UNYZORHTCGXJDF-TWGQIWQCSA-N |
| XLogP | 1.03 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|