C19H13F3N2O2Se — CID 54716554
(2Z,4E)-2-cyano-3-hydroxy-5-phenylselanyl-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 54716554) has the molecular formula C19H13F3N2O2Se and a molecular weight of 437.28 g/mol. Its IUPAC name is (2Z,4E)-2-cyano-3-hydroxy-5-phenylselanyl-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2-cyano-3-hydroxy-5-phenylselanyl-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 54716554 |
| Molecular Formula | C19H13F3N2O2Se |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | (2Z,4E)-2-cyano-3-hydroxy-5-phenylselanyl-N-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | N#C/C(C(=O)Nc1ccc(C(F)(F)F)cc1)=C(O)\C=C\[Se]c1ccccc1 |
| InChI | InChI=1S/C19H13F3N2O2Se/c20-19(21,22)13-6-8-14(9-7-13)24-18(26)16(12-23)17(25)10-11-27-15-4-2-1-3-5-15/h1-11,25H,(H,24,26)/b11-10+,17-16- |
| InChIKey | JQPGWIUXVPEEIJ-RMJOMTDHSA-N |
| XLogP | 3.52 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|