About (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one
(2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one (PubChem CID 54722126) has the molecular formula C12H12O6
and a molecular weight of 252.22 g/mol. Its IUPAC name is (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one |
| PubChem CID | 54722126 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one |
| SMILES | O=C1O[C@@H]([C@@H](O)COc2ccccc2)C(O)=C1O |
| InChI | InChI=1S/C12H12O6/c13-8(6-17-7-4-2-1-3-5-7)11-9(14)10(15)12(16)18-11/h1-5,8,11,13-15H,6H2/t8-,11-/m0/s1 |
| InChIKey | MYMZCINUHKRPGY-KWQFWETISA-N |
| XLogP | 0.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one?
The IUPAC name of (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one (CID 54722126) is (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one.
What is the SMILES notation for (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one?
The canonical SMILES for (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one is O=C1O[C@@H]([C@@H](O)COc2ccccc2)C(O)=C1O.
What is the InChIKey of (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one?
The InChIKey is MYMZCINUHKRPGY-KWQFWETISA-N. The full InChI is InChI=1S/C12H12O6/c13-8(6-17-7-4-2-1-3-5-7)11-9(14)10(15)12(16)18-11/h1-5,8,11,13-15H,6H2/t8-,11-/m0/s1.
What are the key properties of (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one?
(2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one has a molecular weight of 252.22 g/mol, XLogP of 0.68, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-dihydroxy-2-[(1S)-1-hydroxy-2-phenoxyethyl]-2H-furan-5-one is sourced from PubChem (CID 54722126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).