C16H10F2N2O2S2 — CID 54725581
13-(difluoromethyl)-6-hydroxy-11-(5-methylthiophen-2-yl)-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one (PubChem CID 54725581) has the molecular formula C16H10F2N2O2S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 13-(difluoromethyl)-6-hydroxy-11-(5-methylthiophen-2-yl)-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one.
| Compound Name | 13-(difluoromethyl)-6-hydroxy-11-(5-methylthiophen-2-yl)-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
|---|---|
| PubChem CID | 54725581 |
| Molecular Formula | C16H10F2N2O2S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 13-(difluoromethyl)-6-hydroxy-11-(5-methylthiophen-2-yl)-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
| SMILES | Cc1ccc(-c2cc(C(F)F)c3c(n2)sc2c(O)cc(=O)[nH]c23)s1 |
| InChI | InChI=1S/C16H10F2N2O2S2/c1-6-2-3-10(23-6)8-4-7(15(17)18)12-13-14(24-16(12)19-8)9(21)5-11(22)20-13/h2-5,15H,1H3,(H2,20,21,22) |
| InChIKey | ZZDAPZFIIOIBFI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |