C24H40N6O3 — CID 54766921
N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-1-phenylethyl]amino]pentan-2-yl]-2-ethyl-2-(2-methylpropanoylamino)butanamide (PubChem CID 54766921) has the molecular formula C24H40N6O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-1-phenylethyl]amino]pentan-2-yl]-2-ethyl-2-(2-methylpropanoylamino)butanamide.
| Compound Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-1-phenylethyl]amino]pentan-2-yl]-2-ethyl-2-(2-methylpropanoylamino)butanamide |
|---|---|
| PubChem CID | 54766921 |
| Molecular Formula | C24H40N6O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-[[(1S)-1-phenylethyl]amino]pentan-2-yl]-2-ethyl-2-(2-methylpropanoylamino)butanamide |
| SMILES | CCC(CC)(NC(=O)C(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H40N6O3/c1-6-24(7-2,30-20(31)16(3)4)22(33)29-19(14-11-15-27-23(25)26)21(32)28-17(5)18-12-9-8-10-13-18/h8-10,12-13,16-17,19H,6-7,11,14-15H2,1-5H3,(H,28,32)(H,29,33)(H,30,31)(H4,25,26,27)/t17-,19-/m0/s1 |
| InChIKey | MLYMADLRBKQWIH-HKUYNNGSSA-N |
| XLogP | 1.73 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|