C20H23N3O6S — CID 54783666
(Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide (PubChem CID 54783666) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 54783666 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (Z)-2-acetamido-3-(3,4-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C(\NC(C)=O)C(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H23N3O6S/c1-13(24)23-17(10-15-6-9-18(28-2)19(11-15)29-3)20(25)22-12-14-4-7-16(8-5-14)30(21,26)27/h4-11H,12H2,1-3H3,(H,22,25)(H,23,24)(H2,21,26,27)/b17-10- |
| InChIKey | ABFXBHBYIJUDDT-YVLHZVERSA-N |
| XLogP | 1.14 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|