C24H30Cl2N2O4 — CID 54784120
N'-[2-(2,4-dichlorophenoxy)propanoyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanehydrazide (PubChem CID 54784120) has the molecular formula C24H30Cl2N2O4 and a molecular weight of 481.42 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)propanoyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanehydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanehydrazide |
|---|---|
| PubChem CID | 54784120 |
| Molecular Formula | C24H30Cl2N2O4 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanehydrazide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NNC(=O)C(C)Oc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C24H30Cl2N2O4/c1-15-7-8-16(2)21(13-15)31-12-6-11-24(4,5)23(30)28-27-22(29)17(3)32-20-10-9-18(25)14-19(20)26/h7-10,13-14,17H,6,11-12H2,1-5H3,(H,27,29)(H,28,30) |
| InChIKey | BNBFZPXXQHNPHQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|