C27H37N3O3S — CID 54784279
N-butyl-2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide (PubChem CID 54784279) has the molecular formula C27H37N3O3S and a molecular weight of 483.68 g/mol. Its IUPAC name is N-butyl-2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide.
| Compound Name | N-butyl-2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 54784279 |
| Molecular Formula | C27H37N3O3S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N-butyl-2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=S)NC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C27H37N3O3S/c1-6-7-16-28-24(31)21-11-8-9-12-22(21)29-26(34)30-25(32)27(4,5)15-10-17-33-23-18-19(2)13-14-20(23)3/h8-9,11-14,18H,6-7,10,15-17H2,1-5H3,(H,28,31)(H2,29,30,32,34) |
| InChIKey | GHZDDUTZGKOTLQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|