C18H21N3O5 — CID 548211
ethyl 5-(2-benzamido-3-ethoxy-3-oxopropyl)-1H-imidazole-2-carboxylate (PubChem CID 548211) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl 5-(2-benzamido-3-ethoxy-3-oxopropyl)-1H-imidazole-2-carboxylate.
| Compound Name | ethyl 5-(2-benzamido-3-ethoxy-3-oxopropyl)-1H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 548211 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl 5-(2-benzamido-3-ethoxy-3-oxopropyl)-1H-imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(CC(NC(=O)c2ccccc2)C(=O)OCC)[nH]1 |
| InChI | InChI=1S/C18H21N3O5/c1-3-25-17(23)14(21-16(22)12-8-6-5-7-9-12)10-13-11-19-15(20-13)18(24)26-4-2/h5-9,11,14H,3-4,10H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | CCEVDJRWRHVWJX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |