C23H32N2O4 — CID 54852924
N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]-4-heptoxybenzamide (PubChem CID 54852924) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]-4-heptoxybenzamide.
| Compound Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 54852924 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(CO)C(O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O4/c1-2-3-4-5-6-15-29-20-13-9-18(10-14-20)23(28)25-21(16-26)22(27)17-7-11-19(24)12-8-17/h7-14,21-22,26-27H,2-6,15-16,24H2,1H3,(H,25,28) |
| InChIKey | ZZOCYWHLCUNMOY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|