C43H45N7O9S — CID 5497211
5-[4-[5-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]pentanoylamino]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 5497211) has the molecular formula C43H45N7O9S and a molecular weight of 835.94 g/mol. Its IUPAC name is 5-[4-[5-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]pentanoylamino]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[4-[5-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]pentanoylamino]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 5497211 |
| Molecular Formula | C43H45N7O9S |
| Molecular Weight | 835.94 g/mol |
| Exact Mass | 835.30 |
| IUPAC Name | 5-[4-[5-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]pentanoylamino]butylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCCCC(=O)NCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C43H45N7O9S/c1-56-35-18-24(17-25-23-48-42(45)50-40(25)44)19-36(57-2)39(35)58-16-6-3-7-37(53)46-14-4-5-15-47-43(60)49-26-8-11-29(32(20-26)41(54)55)38-30-12-9-27(51)21-33(30)59-34-22-28(52)10-13-31(34)38/h8-13,18-23,51H,3-7,14-17H2,1-2H3,(H,46,53)(H,54,55)(H2,47,49,60)(H4,44,45,48,50) |
| InChIKey | IXYCTOSKDBUYRM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 246.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.94 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|