C17H17BrIN3O3 — CID 5498614
N-[(Z)-(3-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2-(4-iodo-3-methylanilino)acetamide (PubChem CID 5498614) has the molecular formula C17H17BrIN3O3 and a molecular weight of 518.15 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2-(4-iodo-3-methylanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2-(4-iodo-3-methylanilino)acetamide |
|---|---|
| PubChem CID | 5498614 |
| Molecular Formula | C17H17BrIN3O3 |
| Molecular Weight | 518.15 g/mol |
| Exact Mass | 516.95 |
| IUPAC Name | N-[(Z)-(3-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2-(4-iodo-3-methylanilino)acetamide |
| SMILES | COc1c(O)cc(/C=N\NC(=O)CNc2ccc(I)c(C)c2)cc1Br |
| InChI | InChI=1S/C17H17BrIN3O3/c1-10-5-12(3-4-14(10)19)20-9-16(24)22-21-8-11-6-13(18)17(25-2)15(23)7-11/h3-8,20,23H,9H2,1-2H3,(H,22,24)/b21-8- |
| InChIKey | NIHGKBJUBIUBAB-WNFQYIGGSA-N |
| XLogP | 3.64 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.15 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|