C8H15ClO — CID 55301738
trans-(1R,2S)-1-(2-chloroethoxy)-2-propan-2-ylcyclopropane (PubChem CID 55301738) has the molecular formula C8H15ClO and a molecular weight of 162.66 g/mol. Its IUPAC name is trans-(1R,2S)-1-(2-chloroethoxy)-2-propan-2-ylcyclopropane.
| Compound Name | trans-(1R,2S)-1-(2-chloroethoxy)-2-propan-2-ylcyclopropane |
|---|---|
| PubChem CID | 55301738 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | trans-(1R,2S)-1-(2-chloroethoxy)-2-propan-2-ylcyclopropane |
| SMILES | CC(C)[C@@H]1C[C@H]1OCCCl |
| InChI | InChI=1S/C8H15ClO/c1-6(2)7-5-8(7)10-4-3-9/h6-8H,3-5H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | SMGZYCZMKYAWDH-JGVFFNPUSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|