C6H7NO3 — CID 55301746
4-oxa-2-azabicyclo[4.2.0]octane-3,5-dione (PubChem CID 55301746) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 4-oxa-2-azabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | 4-oxa-2-azabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 55301746 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 4-oxa-2-azabicyclo[4.2.0]octane-3,5-dione |
| SMILES | O=C1NC2CCC2C(=O)O1 |
| InChI | InChI=1S/C6H7NO3/c8-5-3-1-2-4(3)7-6(9)10-5/h3-4H,1-2H2,(H,7,9) |
| InChIKey | JDCIKJGOSVLVDX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|