C28H47O5PSi3 — CID 553402
[6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl-diphenylphosphane (PubChem CID 553402) has the molecular formula C28H47O5PSi3 and a molecular weight of 578.91 g/mol. Its IUPAC name is [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl-diphenylphosphane.
| Compound Name | [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 553402 |
| Molecular Formula | C28H47O5PSi3 |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl-diphenylphosphane |
| SMILES | COC1OC(CP(c2ccccc2)c2ccccc2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C28H47O5PSi3/c1-29-28-27(33-37(8,9)10)26(32-36(5,6)7)25(31-35(2,3)4)24(30-28)21-34(22-17-13-11-14-18-22)23-19-15-12-16-20-23/h11-20,24-28H,21H2,1-10H3 |
| InChIKey | OPEBNVQKDGSEQO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|