C18H42O6Si4 — CID 553636
bis(trimethylsilyl) 2-methyl-2,4-bis(trimethylsilyloxy)pentanedioate (PubChem CID 553636) has the molecular formula C18H42O6Si4 and a molecular weight of 466.87 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-methyl-2,4-bis(trimethylsilyloxy)pentanedioate.
| Compound Name | bis(trimethylsilyl) 2-methyl-2,4-bis(trimethylsilyloxy)pentanedioate |
|---|---|
| PubChem CID | 553636 |
| Molecular Formula | C18H42O6Si4 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | bis(trimethylsilyl) 2-methyl-2,4-bis(trimethylsilyloxy)pentanedioate |
| SMILES | CC(CC(O[Si](C)(C)C)C(=O)O[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O6Si4/c1-18(24-28(11,12)13,17(20)23-27(8,9)10)14-15(21-25(2,3)4)16(19)22-26(5,6)7/h15H,14H2,1-13H3 |
| InChIKey | DREBYTFSFSHNDA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|