C22H25Cl2N3O5 — CID 55377186
N-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-(4-methoxyphenyl)-3-oxopropyl]acetamide (PubChem CID 55377186) has the molecular formula C22H25Cl2N3O5 and a molecular weight of 482.36 g/mol. Its IUPAC name is N-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-(4-methoxyphenyl)-3-oxopropyl]acetamide.
| Compound Name | N-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-(4-methoxyphenyl)-3-oxopropyl]acetamide |
|---|---|
| PubChem CID | 55377186 |
| Molecular Formula | C22H25Cl2N3O5 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-1-(4-methoxyphenyl)-3-oxopropyl]acetamide |
| SMILES | COc1ccc(C(CC(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)NC(C)=O)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O5/c1-14(28)25-19(15-5-8-17(31-2)9-6-15)13-22(30)27-26-21(29)4-3-11-32-20-10-7-16(23)12-18(20)24/h5-10,12,19H,3-4,11,13H2,1-2H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | WJWOIZKQQWSBGH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|