C22H25ClN4O5 — CID 55416223
4-chloro-N-[3-methyl-1-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 55416223) has the molecular formula C22H25ClN4O5 and a molecular weight of 460.92 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55416223 |
| Molecular Formula | C22H25ClN4O5 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-[methyl-[[4-(methylcarbamoyl)phenyl]methyl]amino]-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)C(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(C)C)cc1 |
| InChI | InChI=1S/C22H25ClN4O5/c1-13(2)19(25-21(29)16-9-10-17(23)18(11-16)27(31)32)22(30)26(4)12-14-5-7-15(8-6-14)20(28)24-3/h5-11,13,19H,12H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | JUNBCQVYCUTBEI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|