C23H22F2N2O3S2 — CID 55433243
2-[4-(difluoromethylsulfanyl)anilino]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 55433243) has the molecular formula C23H22F2N2O3S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55433243 |
| Molecular Formula | C23H22F2N2O3S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1Nc1ccc(SC(F)F)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22F2N2O3S2/c1-15(16-7-13-19(14-8-16)32(2,29)30)26-22(28)20-5-3-4-6-21(20)27-17-9-11-18(12-10-17)31-23(24)25/h3-15,23,27H,1-2H3,(H,26,28) |
| InChIKey | SSORSNBIERUPPR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |