C22H22ClN3O3 — CID 55477485
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 6-chloro-2-methylquinoline-3-carboxylate (PubChem CID 55477485) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 6-chloro-2-methylquinoline-3-carboxylate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 6-chloro-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55477485 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 6-chloro-2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2ccc(Cl)cc2cc1C(=O)OC(C)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-13-19(12-15-11-16(23)5-10-20(15)24-13)22(28)29-14(2)21(27)25-17-6-8-18(9-7-17)26(3)4/h5-12,14H,1-4H3,(H,25,27) |
| InChIKey | FGOBFQQDFPPRAG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|