C17H17Cl3N4O3 — CID 55308654
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 55308654) has the molecular formula C17H17Cl3N4O3 and a molecular weight of 431.71 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 55308654 |
| Molecular Formula | C17H17Cl3N4O3 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CC(OC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H17Cl3N4O3/c1-8(16(25)22-9-4-6-10(7-5-9)24(2)3)27-17(26)14-11(18)13(21)12(19)15(20)23-14/h4-8H,1-3H3,(H2,21,23)(H,22,25) |
| InChIKey | JIQWPBVPMCVRDY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|