C21H21N5O5S — CID 55487454
N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 55487454) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55487454 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N'-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2cccc(N3CCCS3(=O)=O)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H21N5O5S/c1-2-25-21(29)17-10-4-3-9-16(17)18(24-25)20(28)23-22-19(27)14-7-5-8-15(13-14)26-11-6-12-32(26,30)31/h3-5,7-10,13H,2,6,11-12H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | HSGXCCRMAUWRIF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|