C24H18N2O6 — CID 55515344
methyl 1-[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]-2,3-dihydroindole-5-carboxylate (PubChem CID 55515344) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is methyl 1-[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 55515344 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | methyl 1-[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2C(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C24H18N2O6/c1-31-24(30)16-5-7-20-14(11-16)8-9-25(20)21(27)15-4-6-18-19(12-15)23(29)26(22(18)28)13-17-3-2-10-32-17/h2-7,10-12H,8-9,13H2,1H3 |
| InChIKey | NKOUOBOOSSCBJQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|