C27H31ClN4O3 — CID 55518871
[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 55518871) has the molecular formula C27H31ClN4O3 and a molecular weight of 495.02 g/mol. Its IUPAC name is [4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55518871 |
| Molecular Formula | C27H31ClN4O3 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCCC(c3nnc4n3CCCCC4)C2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H31ClN4O3/c1-34-24-16-19(12-13-23(24)35-18-21-8-4-5-10-22(21)28)27(33)31-14-7-9-20(17-31)26-30-29-25-11-3-2-6-15-32(25)26/h4-5,8,10,12-13,16,20H,2-3,6-7,9,11,14-15,17-18H2,1H3 |
| InChIKey | ITMJFHDDYVLVKM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |