C21H20ClN3O6 — CID 55535530
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55535530) has the molecular formula C21H20ClN3O6 and a molecular weight of 445.86 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55535530 |
| Molecular Formula | C21H20ClN3O6 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Oc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C21H20ClN3O6/c1-11(2)19(24-20(27)13-3-6-15(22)17(10-13)25(29)30)21(28)31-14-5-7-16-12(9-14)4-8-18(26)23-16/h3,5-7,9-11,19H,4,8H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | KQPALJNRSZYVAU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|